C24H32O11 — CID 15226312
[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] (4S)-4-prop-1-en-2-ylcyclohexene-1-carboxylate (PubChem CID 15226312) has the molecular formula C24H32O11 and a molecular weight of 496.51 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] (4S)-4-prop-1-en-2-ylcyclohexene-1-carboxylate.
| Compound Name | [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] (4S)-4-prop-1-en-2-ylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 15226312 |
| Molecular Formula | C24H32O11 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] (4S)-4-prop-1-en-2-ylcyclohexene-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CC=C(C(=O)O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)CC1 |
| InChI | InChI=1S/C24H32O11/c1-12(2)17-7-9-18(10-8-17)23(29)35-24-22(33-16(6)28)21(32-15(5)27)20(31-14(4)26)19(34-24)11-30-13(3)25/h9,17,19-22,24H,1,7-8,10-11H2,2-6H3/t17-,19-,20-,21+,22-,24+/m1/s1 |
| InChIKey | RXFAHMDDDPTSEU-RAJULGPLSA-N |
| XLogP | 1.92 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|