C26H25NO5 — CID 15230247
2-[[1-[2-(benzhydryloxyamino)-2-oxoethyl]-2,3-dihydro-1H-inden-4-yl]oxy]acetic acid (PubChem CID 15230247) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-[[1-[2-(benzhydryloxyamino)-2-oxoethyl]-2,3-dihydro-1H-inden-4-yl]oxy]acetic acid.
| Compound Name | 2-[[1-[2-(benzhydryloxyamino)-2-oxoethyl]-2,3-dihydro-1H-inden-4-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 15230247 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[[1-[2-(benzhydryloxyamino)-2-oxoethyl]-2,3-dihydro-1H-inden-4-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1CCC2CC(=O)NOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H25NO5/c28-24(16-20-14-15-22-21(20)12-7-13-23(22)31-17-25(29)30)27-32-26(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-13,20,26H,14-17H2,(H,27,28)(H,29,30) |
| InChIKey | RNLQXIDXGMJACN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|