C28H27NO4 — CID 57017782
2-[[6-[2-(benzhydryloxyamino)prop-1-enyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 57017782) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[[6-[2-(benzhydryloxyamino)prop-1-enyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[6-[2-(benzhydryloxyamino)prop-1-enyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 57017782 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-[[6-[2-(benzhydryloxyamino)prop-1-enyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | CC(=CC1=Cc2cccc(OCC(=O)O)c2CC1)NOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H27NO4/c1-20(29-33-28(22-9-4-2-5-10-22)23-11-6-3-7-12-23)17-21-15-16-25-24(18-21)13-8-14-26(25)32-19-27(30)31/h2-14,17-18,28-29H,15-16,19H2,1H3,(H,30,31) |
| InChIKey | MBBFTMXIWXZEHJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|