C29H29NO4 — CID 57279305
methyl 2-[[6-[3-(benzhydryloxyamino)propa-1,2-dienyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetate (PubChem CID 57279305) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is methyl 2-[[6-[3-(benzhydryloxyamino)propa-1,2-dienyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetate.
| Compound Name | methyl 2-[[6-[3-(benzhydryloxyamino)propa-1,2-dienyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetate |
|---|---|
| PubChem CID | 57279305 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | methyl 2-[[6-[3-(benzhydryloxyamino)propa-1,2-dienyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetate |
| SMILES | COC(=O)COc1cccc2c1CCC(C=C=CNOC(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C29H29NO4/c1-32-28(31)21-33-27-16-8-15-25-20-22(17-18-26(25)27)10-9-19-30-34-29(23-11-4-2-5-12-23)24-13-6-3-7-14-24/h2-8,10-16,19,22,29-30H,17-18,20-21H2,1H3 |
| InChIKey | ZVXMNAAYMXJLTL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|