C31H34O4 — CID 57306674
2-[[6-(4-benzhydryloxyhex-1-enyl)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 57306674) has the molecular formula C31H34O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2-[[6-(4-benzhydryloxyhex-1-enyl)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[6-(4-benzhydryloxyhex-1-enyl)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 57306674 |
| Molecular Formula | C31H34O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[[6-(4-benzhydryloxyhex-1-enyl)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | CCC(CC=CC1CCc2c(cccc2OCC(=O)O)C1)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H34O4/c1-2-27(35-31(24-12-5-3-6-13-24)25-14-7-4-8-15-25)17-9-11-23-19-20-28-26(21-23)16-10-18-29(28)34-22-30(32)33/h3-16,18,23,27,31H,2,17,19-22H2,1H3,(H,32,33) |
| InChIKey | PBYLDGCNEBBERC-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|