C30H33NO4 — CID 19377470
2-[[6-[3-(benzhydryloxyamino)pentyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 19377470) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is 2-[[6-[3-(benzhydryloxyamino)pentyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[6-[3-(benzhydryloxyamino)pentyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 19377470 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 2-[[6-[3-(benzhydryloxyamino)pentyl]-7,8-dihydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | CCC(CCC1=Cc2cccc(OCC(=O)O)c2CC1)NOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33NO4/c1-2-26(31-35-30(23-10-5-3-6-11-23)24-12-7-4-8-13-24)18-16-22-17-19-27-25(20-22)14-9-15-28(27)34-21-29(32)33/h3-15,20,26,30-31H,2,16-19,21H2,1H3,(H,32,33) |
| InChIKey | BVOTZPIYODBQIT-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|