C10H19N3O — CID 15231631
2-ethyl-8-methyl-1,2,8-triazaspiro[4.5]decan-3-one (PubChem CID 15231631) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-ethyl-8-methyl-1,2,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 2-ethyl-8-methyl-1,2,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 15231631 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-ethyl-8-methyl-1,2,8-triazaspiro[4.5]decan-3-one |
| SMILES | CCN1NC2(CCN(C)CC2)CC1=O |
| InChI | InChI=1S/C10H19N3O/c1-3-13-9(14)8-10(11-13)4-6-12(2)7-5-10/h11H,3-8H2,1-2H3 |
| InChIKey | LUOXUVHCRINTKN-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |