C25H36O3 — CID 15233988
2-[(6E,10E)-3-hydroxy-7,11,15-trimethylhexadeca-6,10,14-trienyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 15233988) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is 2-[(6E,10E)-3-hydroxy-7,11,15-trimethylhexadeca-6,10,14-trienyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(6E,10E)-3-hydroxy-7,11,15-trimethylhexadeca-6,10,14-trienyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15233988 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 2-[(6E,10E)-3-hydroxy-7,11,15-trimethylhexadeca-6,10,14-trienyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(O)CCC1=CC(=O)C=CC1=O |
| InChI | InChI=1S/C25H36O3/c1-19(2)8-5-9-20(3)10-6-11-21(4)12-7-13-23(26)15-14-22-18-24(27)16-17-25(22)28/h8,10,12,16-18,23,26H,5-7,9,11,13-15H2,1-4H3/b20-10+,21-12+ |
| InChIKey | QHSAADHCQKGMNS-YARIIHNNSA-N |
| XLogP | 5.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|