C16H10N2O8 — CID 15236425
2,9-bis(methoxycarbonyl)-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-7-carboxylic acid (PubChem CID 15236425) has the molecular formula C16H10N2O8 and a molecular weight of 358.26 g/mol. Its IUPAC name is 2,9-bis(methoxycarbonyl)-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-7-carboxylic acid.
| Compound Name | 2,9-bis(methoxycarbonyl)-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 15236425 |
| Molecular Formula | C16H10N2O8 |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2,9-bis(methoxycarbonyl)-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-7-carboxylic acid |
| SMILES | COC(=O)c1cc2c([nH]1)-c1c(C(=O)OC)cc(C(=O)O)nc1C(=O)C2=O |
| InChI | InChI=1S/C16H10N2O8/c1-25-15(23)5-3-7(14(21)22)17-11-9(5)10-6(12(19)13(11)20)4-8(18-10)16(24)26-2/h3-4,18H,1-2H3,(H,21,22) |
| InChIKey | ZCRUKQPSMHJVTK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 152.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|