C15H11ClF3N3O — CID 15238980
2-chloro-5-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydro-1H-pyrazol-5-yl]pyridine (PubChem CID 15238980) has the molecular formula C15H11ClF3N3O and a molecular weight of 341.72 g/mol. Its IUPAC name is 2-chloro-5-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydro-1H-pyrazol-5-yl]pyridine.
| Compound Name | 2-chloro-5-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydro-1H-pyrazol-5-yl]pyridine |
|---|---|
| PubChem CID | 15238980 |
| Molecular Formula | C15H11ClF3N3O |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-chloro-5-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydro-1H-pyrazol-5-yl]pyridine |
| SMILES | FC(F)(F)Oc1ccc(C2=NNC(c3ccc(Cl)nc3)C2)cc1 |
| InChI | InChI=1S/C15H11ClF3N3O/c16-14-6-3-10(8-20-14)13-7-12(21-22-13)9-1-4-11(5-2-9)23-15(17,18)19/h1-6,8,13,22H,7H2 |
| InChIKey | SYALMHGRVLPHKA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|