C19H19Cl2NO4 — CID 15240296
benzyl [2,3-dichloro-4-(2,2-dimethylpropanoylamino)phenyl] carbonate (PubChem CID 15240296) has the molecular formula C19H19Cl2NO4 and a molecular weight of 396.27 g/mol. Its IUPAC name is benzyl [2,3-dichloro-4-(2,2-dimethylpropanoylamino)phenyl] carbonate.
| Compound Name | benzyl [2,3-dichloro-4-(2,2-dimethylpropanoylamino)phenyl] carbonate |
|---|---|
| PubChem CID | 15240296 |
| Molecular Formula | C19H19Cl2NO4 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | benzyl [2,3-dichloro-4-(2,2-dimethylpropanoylamino)phenyl] carbonate |
| SMILES | CC(C)(C)C(=O)Nc1ccc(OC(=O)OCc2ccccc2)c(Cl)c1Cl |
| InChI | InChI=1S/C19H19Cl2NO4/c1-19(2,3)17(23)22-13-9-10-14(16(21)15(13)20)26-18(24)25-11-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3,(H,22,23) |
| InChIKey | FDDJZSUSLHKSMG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|