C24H29NO4 — CID 102498622
benzyl 2-[2-(2,2-dimethylpropanoylamino)-4,5-dimethylphenyl]-3-oxobutanoate (PubChem CID 102498622) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is benzyl 2-[2-(2,2-dimethylpropanoylamino)-4,5-dimethylphenyl]-3-oxobutanoate.
| Compound Name | benzyl 2-[2-(2,2-dimethylpropanoylamino)-4,5-dimethylphenyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 102498622 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | benzyl 2-[2-(2,2-dimethylpropanoylamino)-4,5-dimethylphenyl]-3-oxobutanoate |
| SMILES | CC(=O)C(C(=O)OCc1ccccc1)c1cc(C)c(C)cc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C24H29NO4/c1-15-12-19(20(13-16(15)2)25-23(28)24(4,5)6)21(17(3)26)22(27)29-14-18-10-8-7-9-11-18/h7-13,21H,14H2,1-6H3,(H,25,28) |
| InChIKey | HLKQCRIEJWDPDA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|