C30H61N3O — CID 152511166
N-[5-[2-(didecylamino)ethylimino]-2,2-dimethylhexan-3-ylidene]hydroxylamine (PubChem CID 152511166) has the molecular formula C30H61N3O and a molecular weight of 479.84 g/mol. Its IUPAC name is N-[5-[2-(didecylamino)ethylimino]-2,2-dimethylhexan-3-ylidene]hydroxylamine.
| Compound Name | N-[5-[2-(didecylamino)ethylimino]-2,2-dimethylhexan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 152511166 |
| Molecular Formula | C30H61N3O |
| Molecular Weight | 479.84 g/mol |
| Exact Mass | 479.48 |
| IUPAC Name | N-[5-[2-(didecylamino)ethylimino]-2,2-dimethylhexan-3-ylidene]hydroxylamine |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)CC/N=C(\C)CC(=NO)C(C)(C)C |
| InChI | InChI=1S/C30H61N3O/c1-7-9-11-13-15-17-19-21-24-33(25-22-20-18-16-14-12-10-8-2)26-23-31-28(3)27-29(32-34)30(4,5)6/h34H,7-27H2,1-6H3/b31-28+,32-29? |
| InChIKey | YFNLARAUGFDGAW-LUJIPLRMSA-N |
| XLogP | 9.30 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.84 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|