C24H35BrN2O — CID 152517350
2-(3-bromophenyl)-2-cyclohexyl-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone (PubChem CID 152517350) has the molecular formula C24H35BrN2O and a molecular weight of 447.46 g/mol. Its IUPAC name is 2-(3-bromophenyl)-2-cyclohexyl-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone.
| Compound Name | 2-(3-bromophenyl)-2-cyclohexyl-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 152517350 |
| Molecular Formula | C24H35BrN2O |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-(3-bromophenyl)-2-cyclohexyl-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone |
| SMILES | O=C(C(c1cccc(Br)c1)C1CCCCC1)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C24H35BrN2O/c25-21-11-7-10-20(18-21)23(19-8-3-1-4-9-19)24(28)27-16-12-22(13-17-27)26-14-5-2-6-15-26/h7,10-11,18-19,22-23H,1-6,8-9,12-17H2 |
| InChIKey | YGUMOWMFZMSZFC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |