C22H22O3 — CID 152526129
[4-(2-bicyclo[2.2.1]hept-5-enyl)phenyl] 4-ethoxybenzoate (PubChem CID 152526129) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is [4-(2-bicyclo[2.2.1]hept-5-enyl)phenyl] 4-ethoxybenzoate.
| Compound Name | [4-(2-bicyclo[2.2.1]hept-5-enyl)phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 152526129 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | [4-(2-bicyclo[2.2.1]hept-5-enyl)phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C3CC4C=CC3C4)cc2)cc1 |
| InChI | InChI=1S/C22H22O3/c1-2-24-19-9-7-17(8-10-19)22(23)25-20-11-5-16(6-12-20)21-14-15-3-4-18(21)13-15/h3-12,15,18,21H,2,13-14H2,1H3 |
| InChIKey | YIOCTBJNCYVWGF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|