C14H17NO6 — CID 152527625
2-(2-amino-1-hydroperoxy-1,3-dioxo-3-phenylpropan-2-yl)pentanoic acid (PubChem CID 152527625) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-(2-amino-1-hydroperoxy-1,3-dioxo-3-phenylpropan-2-yl)pentanoic acid.
| Compound Name | 2-(2-amino-1-hydroperoxy-1,3-dioxo-3-phenylpropan-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 152527625 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-(2-amino-1-hydroperoxy-1,3-dioxo-3-phenylpropan-2-yl)pentanoic acid |
| SMILES | CCCC(C(=O)O)C(N)(C(=O)OO)C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO6/c1-2-6-10(12(17)18)14(15,13(19)21-20)11(16)9-7-4-3-5-8-9/h3-5,7-8,10,20H,2,6,15H2,1H3,(H,17,18) |
| InChIKey | YIVUMAUGFOLVQU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|