C14H18N2O5 — CID 141297307
2,2-dicarbamoyl-3-phenylhexaneperoxoic acid (PubChem CID 141297307) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2,2-dicarbamoyl-3-phenylhexaneperoxoic acid.
| Compound Name | 2,2-dicarbamoyl-3-phenylhexaneperoxoic acid |
|---|---|
| PubChem CID | 141297307 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2,2-dicarbamoyl-3-phenylhexaneperoxoic acid |
| SMILES | CCCC(c1ccccc1)C(C(N)=O)(C(N)=O)C(=O)OO |
| InChI | InChI=1S/C14H18N2O5/c1-2-6-10(9-7-4-3-5-8-9)14(11(15)17,12(16)18)13(19)21-20/h3-5,7-8,10,20H,2,6H2,1H3,(H2,15,17)(H2,16,18) |
| InChIKey | NMOMJUWOZUVULN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|