About (3-azido-4-fluorophenyl) acetate
(3-azido-4-fluorophenyl) acetate (PubChem CID 152536119) has the molecular formula C8H6FN3O2
and a molecular weight of 195.15 g/mol. Its IUPAC name is (3-azido-4-fluorophenyl) acetate.
Molecular Properties
| Compound Name | (3-azido-4-fluorophenyl) acetate |
| PubChem CID | 152536119 |
| Molecular Formula | C8H6FN3O2 |
| Molecular Weight | 195.15 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | (3-azido-4-fluorophenyl) acetate |
| SMILES | CC(=O)Oc1ccc(F)c(N=[N+]=[N-])c1 |
| InChI | InChI=1S/C8H6FN3O2/c1-5(13)14-6-2-3-7(9)8(4-6)11-12-10/h2-4H,1H3 |
| InChIKey | YKOKUUFCYFNGAU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.15 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3-azido-4-fluorophenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-azido-4-fluorophenyl) acetate?
The IUPAC name of (3-azido-4-fluorophenyl) acetate (CID 152536119) is (3-azido-4-fluorophenyl) acetate.
What is the SMILES notation for (3-azido-4-fluorophenyl) acetate?
The canonical SMILES for (3-azido-4-fluorophenyl) acetate is CC(=O)Oc1ccc(F)c(N=[N+]=[N-])c1.
What is the InChIKey of (3-azido-4-fluorophenyl) acetate?
The InChIKey is YKOKUUFCYFNGAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3O2/c1-5(13)14-6-2-3-7(9)8(4-6)11-12-10/h2-4H,1H3.
What are the key properties of (3-azido-4-fluorophenyl) acetate?
(3-azido-4-fluorophenyl) acetate has a molecular weight of 195.15 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-azido-4-fluorophenyl) acetate is sourced from PubChem (CID 152536119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).