C24H23ClO2 — CID 15253636
1-[[(1S,2R,3R)-2-chloro-1-methyl-3-phenylcyclopropyl]methoxymethyl]-3-phenoxybenzene (PubChem CID 15253636) has the molecular formula C24H23ClO2 and a molecular weight of 378.90 g/mol. Its IUPAC name is 1-[[(1S,2R,3R)-2-chloro-1-methyl-3-phenylcyclopropyl]methoxymethyl]-3-phenoxybenzene.
| Compound Name | 1-[[(1S,2R,3R)-2-chloro-1-methyl-3-phenylcyclopropyl]methoxymethyl]-3-phenoxybenzene |
|---|---|
| PubChem CID | 15253636 |
| Molecular Formula | C24H23ClO2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-[[(1S,2R,3R)-2-chloro-1-methyl-3-phenylcyclopropyl]methoxymethyl]-3-phenoxybenzene |
| SMILES | C[C@]1(COCc2cccc(Oc3ccccc3)c2)[C@H](Cl)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H23ClO2/c1-24(22(23(24)25)19-10-4-2-5-11-19)17-26-16-18-9-8-14-21(15-18)27-20-12-6-3-7-13-20/h2-15,22-23H,16-17H2,1H3/t22-,23+,24+/m0/s1 |
| InChIKey | HQTCLCNRQZJSMF-RBZQAINGSA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|