About ethyl quinoline-4-sulfonate
ethyl quinoline-4-sulfonate (PubChem CID 152547858) has the molecular formula C11H11NO3S
and a molecular weight of 237.28 g/mol. Its IUPAC name is ethyl quinoline-4-sulfonate.
Molecular Properties
| Compound Name | ethyl quinoline-4-sulfonate |
| PubChem CID | 152547858 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | ethyl quinoline-4-sulfonate |
| SMILES | CCOS(=O)(=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C11H11NO3S/c1-2-15-16(13,14)11-7-8-12-10-6-4-3-5-9(10)11/h3-8H,2H2,1H3 |
| InChIKey | YMWCYLLOZLVOMQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl quinoline-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl quinoline-4-sulfonate?
The IUPAC name of ethyl quinoline-4-sulfonate (CID 152547858) is ethyl quinoline-4-sulfonate.
What is the SMILES notation for ethyl quinoline-4-sulfonate?
The canonical SMILES for ethyl quinoline-4-sulfonate is CCOS(=O)(=O)c1ccnc2ccccc12.
What is the InChIKey of ethyl quinoline-4-sulfonate?
The InChIKey is YMWCYLLOZLVOMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c1-2-15-16(13,14)11-7-8-12-10-6-4-3-5-9(10)11/h3-8H,2H2,1H3.
What are the key properties of ethyl quinoline-4-sulfonate?
ethyl quinoline-4-sulfonate has a molecular weight of 237.28 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl quinoline-4-sulfonate is sourced from PubChem (CID 152547858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).