C19H19NO6 — CID 152557915
5-[(4-butoxycarbonylbenzoyl)amino]-2-hydroxybenzoic acid (PubChem CID 152557915) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is 5-[(4-butoxycarbonylbenzoyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[(4-butoxycarbonylbenzoyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 152557915 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 5-[(4-butoxycarbonylbenzoyl)amino]-2-hydroxybenzoic acid |
| SMILES | CCCCOC(=O)c1ccc(C(=O)Nc2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H19NO6/c1-2-3-10-26-19(25)13-6-4-12(5-7-13)17(22)20-14-8-9-16(21)15(11-14)18(23)24/h4-9,11,21H,2-3,10H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | YOWMIMIMZKFLIR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|