C26H22Cl2N2O7 — CID 152558378
2-chloro-7-[4-[2-(4-chlorophenyl)ethylcarbamoyl]-2-nitrophenoxy]-6-methyl-3,4-dihydro-2H-chromene-4-carboxylic acid (PubChem CID 152558378) has the molecular formula C26H22Cl2N2O7 and a molecular weight of 545.38 g/mol. Its IUPAC name is 2-chloro-7-[4-[2-(4-chlorophenyl)ethylcarbamoyl]-2-nitrophenoxy]-6-methyl-3,4-dihydro-2H-chromene-4-carboxylic acid.
| Compound Name | 2-chloro-7-[4-[2-(4-chlorophenyl)ethylcarbamoyl]-2-nitrophenoxy]-6-methyl-3,4-dihydro-2H-chromene-4-carboxylic acid |
|---|---|
| PubChem CID | 152558378 |
| Molecular Formula | C26H22Cl2N2O7 |
| Molecular Weight | 545.38 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | 2-chloro-7-[4-[2-(4-chlorophenyl)ethylcarbamoyl]-2-nitrophenoxy]-6-methyl-3,4-dihydro-2H-chromene-4-carboxylic acid |
| SMILES | Cc1cc2c(cc1Oc1ccc(C(=O)NCCc3ccc(Cl)cc3)cc1[N+](=O)[O-])OC(Cl)CC2C(=O)O |
| InChI | InChI=1S/C26H22Cl2N2O7/c1-14-10-18-19(26(32)33)12-24(28)37-23(18)13-22(14)36-21-7-4-16(11-20(21)30(34)35)25(31)29-9-8-15-2-5-17(27)6-3-15/h2-7,10-11,13,19,24H,8-9,12H2,1H3,(H,29,31)(H,32,33) |
| InChIKey | YOYSYBMYKZEJJW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.38 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|