C9H11NO — CID 152560812
1-azaspiro[4.5]deca-6,9-dien-2-one (PubChem CID 152560812) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 1-azaspiro[4.5]deca-6,9-dien-2-one.
| Compound Name | 1-azaspiro[4.5]deca-6,9-dien-2-one |
|---|---|
| PubChem CID | 152560812 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 1-azaspiro[4.5]deca-6,9-dien-2-one |
| SMILES | O=C1CCC2(C=CCC=C2)N1 |
| InChI | InChI=1S/C9H11NO/c11-8-4-7-9(10-8)5-2-1-3-6-9/h2-3,5-6H,1,4,7H2,(H,10,11) |
| InChIKey | YPLMHKHMHSAQJY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|