C10H13NO — CID 91160729
9-methyl-1-azaspiro[4.5]deca-6,8-dien-2-one (PubChem CID 91160729) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 9-methyl-1-azaspiro[4.5]deca-6,8-dien-2-one.
| Compound Name | 9-methyl-1-azaspiro[4.5]deca-6,8-dien-2-one |
|---|---|
| PubChem CID | 91160729 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 9-methyl-1-azaspiro[4.5]deca-6,8-dien-2-one |
| SMILES | CC1=CC=CC2(CCC(=O)N2)C1 |
| InChI | InChI=1S/C10H13NO/c1-8-3-2-5-10(7-8)6-4-9(12)11-10/h2-3,5H,4,6-7H2,1H3,(H,11,12) |
| InChIKey | XBKDJEQZHDBBCE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |