C18H31NO5 — CID 15256254
tert-butyl 3-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-5-oxopyrrolidin-2-yl]propanoate (PubChem CID 15256254) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-5-oxopyrrolidin-2-yl]propanoate.
| Compound Name | tert-butyl 3-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-5-oxopyrrolidin-2-yl]propanoate |
|---|---|
| PubChem CID | 15256254 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | tert-butyl 3-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-5-oxopyrrolidin-2-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCC1(CCC(=O)OC(C)(C)C)CCC(=O)N1 |
| InChI | InChI=1S/C18H31NO5/c1-16(2,3)23-14(21)8-11-18(10-7-13(20)19-18)12-9-15(22)24-17(4,5)6/h7-12H2,1-6H3,(H,19,20) |
| InChIKey | GXAPBRWALMLZRZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |