C24H19Cl2F4N7O3 — CID 152582075
3-chloro-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(2-fluorocyclopropyl)benzamide (PubChem CID 152582075) has the molecular formula C24H19Cl2F4N7O3 and a molecular weight of 600.36 g/mol. Its IUPAC name is 3-chloro-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(2-fluorocyclopropyl)benzamide.
| Compound Name | 3-chloro-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(2-fluorocyclopropyl)benzamide |
|---|---|
| PubChem CID | 152582075 |
| Molecular Formula | C24H19Cl2F4N7O3 |
| Molecular Weight | 600.36 g/mol |
| Exact Mass | 599.09 |
| IUPAC Name | 3-chloro-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(2-fluorocyclopropyl)benzamide |
| SMILES | O=C(NC1CC1F)c1cccc(Cl)c1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@@H](O)C(F)(F)F)c2=O)n1 |
| InChI | InChI=1S/C24H19Cl2F4N7O3/c25-13-6-4-12(5-7-13)21-34-36(23(40)35(21)9-18(38)24(28,29)30)10-19-31-11-37(33-19)20-14(2-1-3-15(20)26)22(39)32-17-8-16(17)27/h1-7,11,16-18,38H,8-10H2,(H,32,39)/t16?,17?,18-/m1/s1 |
| InChIKey | YTRPDUPOWVAMLI-DAWZGUTISA-N |
| XLogP | 3.41 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |