About [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane
[(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane (PubChem CID 15259647) has the molecular formula C12H19F3O2S
and a molecular weight of 284.34 g/mol. Its IUPAC name is [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane.
Molecular Properties
| Compound Name | [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane |
| PubChem CID | 15259647 |
| Molecular Formula | C12H19F3O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane |
| SMILES | CCS(=O)(=O)/C(=C\CC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H19F3O2S/c1-2-18(16,17)11(12(13,14)15)9-8-10-6-4-3-5-7-10/h9-10H,2-8H2,1H3/b11-9- |
| InChIKey | DLKXGQKFAZHWRQ-LUAWRHEFSA-N |
| XLogP | 3.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane?
The IUPAC name of [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane (CID 15259647) is [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane.
What is the SMILES notation for [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane?
The canonical SMILES for [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane is CCS(=O)(=O)/C(=C\CC1CCCCC1)C(F)(F)F.
What is the InChIKey of [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane?
The InChIKey is DLKXGQKFAZHWRQ-LUAWRHEFSA-N. The full InChI is InChI=1S/C12H19F3O2S/c1-2-18(16,17)11(12(13,14)15)9-8-10-6-4-3-5-7-10/h9-10H,2-8H2,1H3/b11-9-.
What are the key properties of [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane?
[(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane has a molecular weight of 284.34 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane is sourced from PubChem (CID 15259647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).