C12H19F3O2S — CID 15259647
[(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane (PubChem CID 15259647) has the molecular formula C12H19F3O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane.
| Compound Name | [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane |
|---|---|
| PubChem CID | 15259647 |
| Molecular Formula | C12H19F3O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | [(Z)-3-ethylsulfonyl-4,4,4-trifluorobut-2-enyl]cyclohexane |
| SMILES | CCS(=O)(=O)/C(=C\CC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H19F3O2S/c1-2-18(16,17)11(12(13,14)15)9-8-10-6-4-3-5-7-10/h9-10H,2-8H2,1H3/b11-9- |
| InChIKey | DLKXGQKFAZHWRQ-LUAWRHEFSA-N |
| XLogP | 3.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |