C9H13F2O4S- — CID 58100531
3-cyclohexyl-1,1-difluoro-2-oxopropane-1-sulfonate (PubChem CID 58100531) has the molecular formula C9H13F2O4S- and a molecular weight of 255.26 g/mol. Its IUPAC name is 3-cyclohexyl-1,1-difluoro-2-oxopropane-1-sulfonate.
| Compound Name | 3-cyclohexyl-1,1-difluoro-2-oxopropane-1-sulfonate |
|---|---|
| PubChem CID | 58100531 |
| Molecular Formula | C9H13F2O4S- |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 3-cyclohexyl-1,1-difluoro-2-oxopropane-1-sulfonate |
| SMILES | O=C(CC1CCCCC1)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H14F2O4S/c10-9(11,16(13,14)15)8(12)6-7-4-2-1-3-5-7/h7H,1-6H2,(H,13,14,15)/p-1 |
| InChIKey | BXWCIHMXPFEYQK-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|