C20H21F3N5O4S+ — CID 152623709
(2S)-2-[[2-[(4R)-4-(difluoromethyl)-2-formyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl]-8-fluoro-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]-3-methoxypropanamide (PubChem CID 152623709) has the molecular formula C20H21F3N5O4S+ and a molecular weight of 484.48 g/mol. Its IUPAC name is (2S)-2-[[2-[(4R)-4-(difluoromethyl)-2-formyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl]-8-fluoro-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]-3-methoxypropanamide.
| Compound Name | (2S)-2-[[2-[(4R)-4-(difluoromethyl)-2-formyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl]-8-fluoro-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]-3-methoxypropanamide |
|---|---|
| PubChem CID | 152623709 |
| Molecular Formula | C20H21F3N5O4S+ |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (2S)-2-[[2-[(4R)-4-(difluoromethyl)-2-formyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl]-8-fluoro-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]-3-methoxypropanamide |
| SMILES | COC[C@H](Nc1ccc2c(c1F)OCCn1cc([N+]3=C(C=O)SC[C@H]3C(F)F)nc1-2)C(N)=O |
| InChI | InChI=1S/C20H20F3N5O4S/c1-31-8-12(19(24)30)25-11-3-2-10-17(16(11)21)32-5-4-27-6-14(26-20(10)27)28-13(18(22)23)9-33-15(28)7-29/h2-3,6-7,12-13,18H,4-5,8-9H2,1H3,(H2-,24,25,26,30)/p+1/t12-,13-/m0/s1 |
| InChIKey | PIGAGZFJHPYODB-STQMWFEESA-O |
| XLogP | 1.62 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|