C11H11ClF2N4O2 — CID 152627984
1-[5-(difluoromethoxy)-1,4-dimethylpyrazol-3-yl]-5-methylpyrazole-4-carbonyl chloride (PubChem CID 152627984) has the molecular formula C11H11ClF2N4O2 and a molecular weight of 304.68 g/mol. Its IUPAC name is 1-[5-(difluoromethoxy)-1,4-dimethylpyrazol-3-yl]-5-methylpyrazole-4-carbonyl chloride.
| Compound Name | 1-[5-(difluoromethoxy)-1,4-dimethylpyrazol-3-yl]-5-methylpyrazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 152627984 |
| Molecular Formula | C11H11ClF2N4O2 |
| Molecular Weight | 304.68 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-[5-(difluoromethoxy)-1,4-dimethylpyrazol-3-yl]-5-methylpyrazole-4-carbonyl chloride |
| SMILES | Cc1c(-n2ncc(C(=O)Cl)c2C)nn(C)c1OC(F)F |
| InChI | InChI=1S/C11H11ClF2N4O2/c1-5-9(16-17(3)10(5)20-11(13)14)18-6(2)7(4-15-18)8(12)19/h4,11H,1-3H3 |
| InChIKey | ZCXKYNYTQDBTLG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.68 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|