C13H9Cl3F2N2O2S — CID 151453287
2-[2,4-dichloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]phenyl]ethanethioic S-acid (PubChem CID 151453287) has the molecular formula C13H9Cl3F2N2O2S and a molecular weight of 401.65 g/mol. Its IUPAC name is 2-[2,4-dichloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]phenyl]ethanethioic S-acid.
| Compound Name | 2-[2,4-dichloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]phenyl]ethanethioic S-acid |
|---|---|
| PubChem CID | 151453287 |
| Molecular Formula | C13H9Cl3F2N2O2S |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | 2-[2,4-dichloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]phenyl]ethanethioic S-acid |
| SMILES | Cn1nc(-c2cc(CC(=O)S)c(Cl)cc2Cl)c(Cl)c1OC(F)F |
| InChI | InChI=1S/C13H9Cl3F2N2O2S/c1-20-12(22-13(17)18)10(16)11(19-20)6-2-5(3-9(21)23)7(14)4-8(6)15/h2,4,13H,3H2,1H3,(H,21,23) |
| InChIKey | PGXXSLBDPKHDBN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|