C23H19FN6O2S2 — CID 152633609
4-[[(1S,3S,5S)-2-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]-1,2,3-benzothiadiazole-5-carboxamide (PubChem CID 152633609) has the molecular formula C23H19FN6O2S2 and a molecular weight of 494.58 g/mol. Its IUPAC name is 4-[[(1S,3S,5S)-2-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]-1,2,3-benzothiadiazole-5-carboxamide.
| Compound Name | 4-[[(1S,3S,5S)-2-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]-1,2,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 152633609 |
| Molecular Formula | C23H19FN6O2S2 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 4-[[(1S,3S,5S)-2-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]-1,2,3-benzothiadiazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2snnc2c1C[C@@H]1C[C@@H]2C[C@@H]2N1C(=O)c1nc(N)sc1-c1cccc(F)c1 |
| InChI | InChI=1S/C23H19FN6O2S2/c24-12-3-1-2-10(6-12)20-19(27-23(26)33-20)22(32)30-13(7-11-8-16(11)30)9-15-14(21(25)31)4-5-17-18(15)28-29-34-17/h1-6,11,13,16H,7-9H2,(H2,25,31)(H2,26,27)/t11-,13+,16+/m1/s1 |
| InChIKey | ZEBBTKSXBJPVAK-FFSVYQOJSA-N |
| XLogP | 3.48 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |