C23H21FN6O2S2 — CID 150137862
2-[[(1S,3S,5S)-2-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 150137862) has the molecular formula C23H21FN6O2S2 and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-[[(1S,3S,5S)-2-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | 2-[[(1S,3S,5S)-2-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 150137862 |
| Molecular Formula | C23H21FN6O2S2 |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 2-[[(1S,3S,5S)-2-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[3.1.0]hexan-3-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | Cc1nc2sc(C[C@@H]3C[C@@H]4C[C@@H]4N3C(=O)c3nc(N)sc3-c3cccc(F)c3)cn2c1C(N)=O |
| InChI | InChI=1S/C23H21FN6O2S2/c1-10-18(20(25)31)29-9-15(33-23(29)27-10)8-14-6-12-7-16(12)30(14)21(32)17-19(34-22(26)28-17)11-3-2-4-13(24)5-11/h2-5,9,12,14,16H,6-8H2,1H3,(H2,25,31)(H2,26,28)/t12-,14+,16+/m1/s1 |
| InChIKey | FCQFMFUXYVPNAB-INWMFGNUSA-N |
| XLogP | 3.49 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |