C27H38O3 — CID 152634772
3-[dimethoxy(phenyl)methyl]undec-1-en-3-yloxymethylbenzene (PubChem CID 152634772) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is 3-[dimethoxy(phenyl)methyl]undec-1-en-3-yloxymethylbenzene.
| Compound Name | 3-[dimethoxy(phenyl)methyl]undec-1-en-3-yloxymethylbenzene |
|---|---|
| PubChem CID | 152634772 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 3-[dimethoxy(phenyl)methyl]undec-1-en-3-yloxymethylbenzene |
| SMILES | C=CC(CCCCCCCC)(OCc1ccccc1)C(OC)(OC)c1ccccc1 |
| InChI | InChI=1S/C27H38O3/c1-5-7-8-9-10-17-22-26(6-2,30-23-24-18-13-11-14-19-24)27(28-3,29-4)25-20-15-12-16-21-25/h6,11-16,18-21H,2,5,7-10,17,22-23H2,1,3-4H3 |
| InChIKey | ZEHMWGTVEVXZFM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|