C34H54N+ — CID 88769389
1,2-diphenylbut-3-en-2-yl(trihexyl)azanium (PubChem CID 88769389) has the molecular formula C34H54N+ and a molecular weight of 476.81 g/mol. Its IUPAC name is 1,2-diphenylbut-3-en-2-yl(trihexyl)azanium.
| Compound Name | 1,2-diphenylbut-3-en-2-yl(trihexyl)azanium |
|---|---|
| PubChem CID | 88769389 |
| Molecular Formula | C34H54N+ |
| Molecular Weight | 476.81 g/mol |
| Exact Mass | 476.43 |
| IUPAC Name | 1,2-diphenylbut-3-en-2-yl(trihexyl)azanium |
| SMILES | C=CC(Cc1ccccc1)(c1ccccc1)[N+](CCCCCC)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C34H54N/c1-5-9-12-21-28-35(29-22-13-10-6-2,30-23-14-11-7-3)34(8-4,33-26-19-16-20-27-33)31-32-24-17-15-18-25-32/h8,15-20,24-27H,4-7,9-14,21-23,28-31H2,1-3H3/q+1 |
| InChIKey | XGOKFZNUABLPDI-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.81 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|