C28H48O2 — CID 151485020
(2-but-1-enyl-2-ethyl-1,1-dipropoxydecyl)benzene (PubChem CID 151485020) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is (2-but-1-enyl-2-ethyl-1,1-dipropoxydecyl)benzene.
| Compound Name | (2-but-1-enyl-2-ethyl-1,1-dipropoxydecyl)benzene |
|---|---|
| PubChem CID | 151485020 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | (2-but-1-enyl-2-ethyl-1,1-dipropoxydecyl)benzene |
| SMILES | CCC=CC(CC)(CCCCCCCC)C(OCCC)(OCCC)c1ccccc1 |
| InChI | InChI=1S/C28H48O2/c1-6-11-13-14-15-19-23-27(10-5,22-12-7-2)28(29-24-8-3,30-25-9-4)26-20-17-16-18-21-26/h12,16-18,20-22H,6-11,13-15,19,23-25H2,1-5H3 |
| InChIKey | PNGNBBKDWSUOJW-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|