About [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate
[3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate (PubChem CID 152642645) has the molecular formula C10H19O6P
and a molecular weight of 266.23 g/mol. Its IUPAC name is [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate.
Molecular Properties
| Compound Name | [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate |
| PubChem CID | 152642645 |
| Molecular Formula | C10H19O6P |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate |
| SMILES | CC(C)CC(OP(=O)(O)OCC1CO1)C1CO1 |
| InChI | InChI=1S/C10H19O6P/c1-7(2)3-9(10-6-14-10)16-17(11,12)15-5-8-4-13-8/h7-10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | ZFWUATGNAXQLDG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate?
The IUPAC name of [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate (CID 152642645) is [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate.
What is the SMILES notation for [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate?
The canonical SMILES for [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate is CC(C)CC(OP(=O)(O)OCC1CO1)C1CO1.
What is the InChIKey of [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate?
The InChIKey is ZFWUATGNAXQLDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19O6P/c1-7(2)3-9(10-6-14-10)16-17(11,12)15-5-8-4-13-8/h7-10H,3-6H2,1-2H3,(H,11,12).
What are the key properties of [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate?
[3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate has a molecular weight of 266.23 g/mol, XLogP of 1.33, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate is sourced from PubChem (CID 152642645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).