[3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate

C10H19O6P — CID 152642645

IUPAC[3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate
SMILESCC(C)CC(OP(=O)(O)OCC1CO1)C1CO1
InChIInChI=1S/C10H19O6P/c1-7(2)3-9(10-6-14-10)16-17(11,12)15-5-8-4-13-8/h7-10H,3-6H2,1-2H3,(H,11,12)
InChIKeyZFWUATGNAXQLDG-UHFFFAOYSA-N
MW266.23 g/mol
LogP1.33
Rot. Bonds8

About [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate

[3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate (PubChem CID 152642645) has the molecular formula C10H19O6P and a molecular weight of 266.23 g/mol. Its IUPAC name is [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate.

Molecular Properties

Compound Name[3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate
PubChem CID152642645
Molecular FormulaC10H19O6P
Molecular Weight266.23 g/mol
Exact Mass266.09
IUPAC Name[3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate
SMILESCC(C)CC(OP(=O)(O)OCC1CO1)C1CO1
InChIInChI=1S/C10H19O6P/c1-7(2)3-9(10-6-14-10)16-17(11,12)15-5-8-4-13-8/h7-10H,3-6H2,1-2H3,(H,11,12)
InChIKeyZFWUATGNAXQLDG-UHFFFAOYSA-N
XLogP1.33
TPSA80.82 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.23
LogP ≤ 51.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate?
The IUPAC name of [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate (CID 152642645) is [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate.
What is the SMILES notation for [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate?
The canonical SMILES for [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate is CC(C)CC(OP(=O)(O)OCC1CO1)C1CO1.
What is the InChIKey of [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate?
The InChIKey is ZFWUATGNAXQLDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19O6P/c1-7(2)3-9(10-6-14-10)16-17(11,12)15-5-8-4-13-8/h7-10H,3-6H2,1-2H3,(H,11,12).
What are the key properties of [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate?
[3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate has a molecular weight of 266.23 g/mol, XLogP of 1.33, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-1-(oxiran-2-yl)butyl] oxiran-2-ylmethyl hydrogen phosphate is sourced from PubChem (CID 152642645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).