C9H15O5PS — CID 15264598
S-(2-methylpropyl) 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carbothioate (PubChem CID 15264598) has the molecular formula C9H15O5PS and a molecular weight of 266.25 g/mol. Its IUPAC name is S-(2-methylpropyl) 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carbothioate.
| Compound Name | S-(2-methylpropyl) 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carbothioate |
|---|---|
| PubChem CID | 15264598 |
| Molecular Formula | C9H15O5PS |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | S-(2-methylpropyl) 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carbothioate |
| SMILES | CC(C)CSC(=O)C12COP(=O)(OC1)OC2 |
| InChI | InChI=1S/C9H15O5PS/c1-7(2)3-16-8(10)9-4-12-15(11,13-5-9)14-6-9/h7H,3-6H2,1-2H3 |
| InChIKey | BTZKTYSCRIBXDX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|