C18H36NO9P3 — CID 102064719
1-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-N,N-bis[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]methanamine (PubChem CID 102064719) has the molecular formula C18H36NO9P3 and a molecular weight of 503.41 g/mol. Its IUPAC name is 1-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-N,N-bis[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]methanamine.
| Compound Name | 1-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-N,N-bis[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 102064719 |
| Molecular Formula | C18H36NO9P3 |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 1-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-N,N-bis[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]methanamine |
| SMILES | CC1(C)COP(=O)(CN(CP2(=O)OCC(C)(C)CO2)CP2(=O)OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C18H36NO9P3/c1-16(2)7-23-29(20,24-8-16)13-19(14-30(21)25-9-17(3,4)10-26-30)15-31(22)27-11-18(5,6)12-28-31/h7-15H2,1-6H3 |
| InChIKey | POAMTIWIUPZORW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|