C16H32N2O6P2 — CID 164745931
2-[[4-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]piperazin-1-yl]methyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 164745931) has the molecular formula C16H32N2O6P2 and a molecular weight of 410.39 g/mol. Its IUPAC name is 2-[[4-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]piperazin-1-yl]methyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 2-[[4-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]piperazin-1-yl]methyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 164745931 |
| Molecular Formula | C16H32N2O6P2 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[[4-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]piperazin-1-yl]methyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CC1(C)COP(=O)(CN2CCN(CP3(=O)OCC(C)(C)CO3)CC2)OC1 |
| InChI | InChI=1S/C16H32N2O6P2/c1-15(2)9-21-25(19,22-10-15)13-17-5-7-18(8-6-17)14-26(20)23-11-16(3,4)12-24-26/h5-14H2,1-4H3 |
| InChIKey | HJYYUUFXZSRRRK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|