C9H19O5P — CID 54307418
2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]butan-1-ol (PubChem CID 54307418) has the molecular formula C9H19O5P and a molecular weight of 238.22 g/mol. Its IUPAC name is 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]butan-1-ol.
| Compound Name | 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]butan-1-ol |
|---|---|
| PubChem CID | 54307418 |
| Molecular Formula | C9H19O5P |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]butan-1-ol |
| SMILES | CCC(CO)OP1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C9H19O5P/c1-4-8(5-10)14-15(11)12-6-9(2,3)7-13-15/h8,10H,4-7H2,1-3H3 |
| InChIKey | SIMPVCSBEJQPIK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|