C12H22O5P+ — CID 163765168
5,5-dimethyl-2-(7-oxoniabicyclo[4.1.0]heptan-3-ylmethoxy)-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 163765168) has the molecular formula C12H22O5P+ and a molecular weight of 277.28 g/mol. Its IUPAC name is 5,5-dimethyl-2-(7-oxoniabicyclo[4.1.0]heptan-3-ylmethoxy)-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 5,5-dimethyl-2-(7-oxoniabicyclo[4.1.0]heptan-3-ylmethoxy)-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 163765168 |
| Molecular Formula | C12H22O5P+ |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 5,5-dimethyl-2-(7-oxoniabicyclo[4.1.0]heptan-3-ylmethoxy)-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CC1(C)COP(=O)(OCC2CCC3[OH+]C3C2)OC1 |
| InChI | InChI=1S/C12H21O5P/c1-12(2)7-15-18(13,16-8-12)14-6-9-3-4-10-11(5-9)17-10/h9-11H,3-8H2,1-2H3/p+1 |
| InChIKey | MBQFQATYTKZNRX-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 57.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|