C12H18O3 — CID 15266128
4-Tert-butylperoxy-3,4-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 15266128) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 4-tert-butylperoxy-3,4-dimethylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-Tert-butylperoxy-3,4-dimethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 15266128 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 4-tert-butylperoxy-3,4-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=O)C=CC1(C)OOC(C)(C)C |
| InChI | InChI=1S/C12H18O3/c1-9-8-10(13)6-7-12(9,5)15-14-11(2,3)4/h6-8H,1-5H3 |
| InChIKey | BZTGRRXMEFBBLI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | 320 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|