C17H21NO4 — CID 15266340
(1-benzyl-2,5-dioxopyrrolidin-3-yl) hexanoate (PubChem CID 15266340) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (1-benzyl-2,5-dioxopyrrolidin-3-yl) hexanoate.
| Compound Name | (1-benzyl-2,5-dioxopyrrolidin-3-yl) hexanoate |
|---|---|
| PubChem CID | 15266340 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (1-benzyl-2,5-dioxopyrrolidin-3-yl) hexanoate |
| SMILES | CCCCCC(=O)OC1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C17H21NO4/c1-2-3-5-10-16(20)22-14-11-15(19)18(17(14)21)12-13-8-6-4-7-9-13/h4,6-9,14H,2-3,5,10-12H2,1H3 |
| InChIKey | BKFWHPYBIQZUNC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|