C11H26NO3P — CID 15266355
N-(2-diethoxyphosphorylpropan-2-yl)butan-1-amine (PubChem CID 15266355) has the molecular formula C11H26NO3P and a molecular weight of 251.31 g/mol. Its IUPAC name is N-(2-diethoxyphosphorylpropan-2-yl)butan-1-amine.
| Compound Name | N-(2-diethoxyphosphorylpropan-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 15266355 |
| Molecular Formula | C11H26NO3P |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-(2-diethoxyphosphorylpropan-2-yl)butan-1-amine |
| SMILES | CCCCNC(C)(C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H26NO3P/c1-6-9-10-12-11(4,5)16(13,14-7-2)15-8-3/h12H,6-10H2,1-5H3 |
| InChIKey | YCPTXSMGOZRACH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|