C11H28N2O6P2 — CID 23422851
2-[5-(2-phosphonopropan-2-ylamino)pentylamino]propan-2-ylphosphonic acid (PubChem CID 23422851) has the molecular formula C11H28N2O6P2 and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-[5-(2-phosphonopropan-2-ylamino)pentylamino]propan-2-ylphosphonic acid.
| Compound Name | 2-[5-(2-phosphonopropan-2-ylamino)pentylamino]propan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 23422851 |
| Molecular Formula | C11H28N2O6P2 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[5-(2-phosphonopropan-2-ylamino)pentylamino]propan-2-ylphosphonic acid |
| SMILES | CC(C)(NCCCCCNC(C)(C)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C11H28N2O6P2/c1-10(2,20(14,15)16)12-8-6-5-7-9-13-11(3,4)21(17,18)19/h12-13H,5-9H2,1-4H3,(H2,14,15,16)(H2,17,18,19) |
| InChIKey | KDYZXMANBHJCFL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|