C11H14S — CID 152679151
3,5-bis(prop-2-ynyl)thiane (PubChem CID 152679151) has the molecular formula C11H14S and a molecular weight of 178.30 g/mol. Its IUPAC name is 3,5-bis(prop-2-ynyl)thiane.
| Compound Name | 3,5-bis(prop-2-ynyl)thiane |
|---|---|
| PubChem CID | 152679151 |
| Molecular Formula | C11H14S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 3,5-bis(prop-2-ynyl)thiane |
| SMILES | C#CCC1CSCC(CC#C)C1 |
| InChI | InChI=1S/C11H14S/c1-3-5-10-7-11(6-4-2)9-12-8-10/h1-2,10-11H,5-9H2 |
| InChIKey | ZNDWCPBOZPZWDV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|