C5H12N2S — CID 156770129
thiane-3,5-diamine (PubChem CID 156770129) has the molecular formula C5H12N2S and a molecular weight of 132.23 g/mol. Its IUPAC name is thiane-3,5-diamine.
| Compound Name | thiane-3,5-diamine |
|---|---|
| PubChem CID | 156770129 |
| Molecular Formula | C5H12N2S |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | thiane-3,5-diamine |
| SMILES | NC1CSCC(N)C1 |
| InChI | InChI=1S/C5H12N2S/c6-4-1-5(7)3-8-2-4/h4-5H,1-3,6-7H2 |
| InChIKey | KYJFRURKQHJNJI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |