C14H28N4O2 — CID 152692823
2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol (PubChem CID 152692823) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol.
| Compound Name | 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 152692823 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol |
| SMILES | CCCCCCCCCn1cc(C(N)(CO)CO)nn1 |
| InChI | InChI=1S/C14H28N4O2/c1-2-3-4-5-6-7-8-9-18-10-13(16-17-18)14(15,11-19)12-20/h10,19-20H,2-9,11-12,15H2,1H3 |
| InChIKey | ZPXWKEHHIIOEAC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|