C19H16FN — CID 152695468
2-(fluoromethyl)-N,N-diphenylaniline (PubChem CID 152695468) has the molecular formula C19H16FN and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-(fluoromethyl)-N,N-diphenylaniline.
| Compound Name | 2-(fluoromethyl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 152695468 |
| Molecular Formula | C19H16FN |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-(fluoromethyl)-N,N-diphenylaniline |
| SMILES | FCc1ccccc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16FN/c20-15-16-9-7-8-14-19(16)21(17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-14H,15H2 |
| InChIKey | ZQLHVFHTEJBRSZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |